What is the molecular formula of 5-Bromo-2-nitropyridine?
The molecular formula of 5-Bromo-2-nitropyridine is C5H3BrN2O2.
What is the molecular weight of 5-Bromo-2-nitropyridine?
The molecular weight of 5-Bromo-2-nitropyridine is 202.99 g/mol.
What is the IUPAC name of 5-Bromo-2-nitropyridine?
The IUPAC name of 5-Bromo-2-nitropyridine is 5-bromo-2-nitropyridine.
What is the InChI of 5-Bromo-2-nitropyridine?
The InChI of 5-Bromo-2-nitropyridine is InChI=1S/C5H3BrN2O2/c6-4-1-2-5(7-3-4)8(9)10/h1-3H.
What is the InChIKey of 5-Bromo-2-nitropyridine?
The InChIKey of 5-Bromo-2-nitropyridine is ATXXLNCPVSUCNK-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Bromo-2-nitropyridine?
The canonical SMILES of 5-Bromo-2-nitropyridine is C1=CC(=NC=C1Br)[N+](=O)[O-].
What is the CAS number of 5-Bromo-2-nitropyridine?
The CAS number of 5-Bromo-2-nitropyridine is 39856-50-3.
What is the European Community (EC) number of 5-Bromo-2-nitropyridine?
The European Community (EC) number of 5-Bromo-2-nitropyridine is 609-748-8.
What is the DSSTox Substance ID of 5-Bromo-2-nitropyridine?
The DSSTox Substance ID of 5-Bromo-2-nitropyridine is DTXSID20355827.
Is 5-Bromo-2-nitropyridine a canonicalized compound?
Yes, 5-Bromo-2-nitropyridine is a canonicalized compound.