What is the molecular formula of 2-Nitrobenzyl bromide?
The molecular formula of 2-Nitrobenzyl bromide is C7H6BrNO2.
What is the molecular weight of 2-Nitrobenzyl bromide?
The molecular weight of 2-Nitrobenzyl bromide is 216.03 g/mol.
What is the IUPAC name of 2-Nitrobenzyl bromide?
The IUPAC name of 2-Nitrobenzyl bromide is 1-(bromomethyl)-2-nitrobenzene.
What is the InChI of 2-Nitrobenzyl bromide?
The InChI of 2-Nitrobenzyl bromide is InChI=1S/C7H6BrNO2/c8-5-6-3-1-2-4-7(6)9(10)11/h1-4H,5H2.
What is the InChIKey of 2-Nitrobenzyl bromide?
The InChIKey of 2-Nitrobenzyl bromide is HXBMIQJOSHZCFX-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Nitrobenzyl bromide?
The canonical SMILES of 2-Nitrobenzyl bromide is C1=CC=C(C(=C1)CBr)[N+](=O)[O-].
What is the CAS number of 2-Nitrobenzyl bromide?
The CAS number of 2-Nitrobenzyl bromide is 3958-60-9.
What is the European Community (EC) number of 2-Nitrobenzyl bromide?
The European Community (EC) number of 2-Nitrobenzyl bromide is 223-558-9.
What is the ChEMBL ID of 2-Nitrobenzyl bromide?
The ChEMBL ID of 2-Nitrobenzyl bromide is CHEMBL172430.
Is 2-Nitrobenzyl bromide a covalently-bonded unit?
Yes, 2-Nitrobenzyl bromide is a covalently-bonded unit with a count of 1.