What is the molecular formula of 5-Bromo-2-chlorophenol?
The molecular formula of 5-Bromo-2-chlorophenol is C6H4BrClO.
What is the molecular weight of 5-Bromo-2-chlorophenol?
The molecular weight of 5-Bromo-2-chlorophenol is 207.45 g/mol.
What is the IUPAC name of 5-Bromo-2-chlorophenol?
The IUPAC name of 5-Bromo-2-chlorophenol is 5-bromo-2-chlorophenol.
What is the InChI of 5-Bromo-2-chlorophenol?
The InChI of 5-Bromo-2-chlorophenol is InChI=1S/C6H4BrClO/c7-4-1-2-5(8)6(9)3-4/h1-3,9H.
What is the InChIKey of 5-Bromo-2-chlorophenol?
The InChIKey of 5-Bromo-2-chlorophenol is UEVFFMZHGNYDKM-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Bromo-2-chlorophenol?
The canonical SMILES of 5-Bromo-2-chlorophenol is C1=CC(=C(C=C1Br)O)Cl.
What is the CAS number of 5-Bromo-2-chlorophenol?
The CAS number of 5-Bromo-2-chlorophenol is 183802-98-4.
How many hydrogen bond donor counts does 5-Bromo-2-chlorophenol have?
5-Bromo-2-chlorophenol has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 5-Bromo-2-chlorophenol have?
5-Bromo-2-chlorophenol has 1 hydrogen bond acceptor count.