What is the molecular formula of 5-Bromo-1H-benzotriazole?
The molecular formula is C6H4BrN3.
What is the molecular weight of 5-Bromo-1H-benzotriazole?
The molecular weight is 198.02 g/mol.
What is the IUPAC name of 5-Bromo-1H-benzotriazole?
The IUPAC name is 5-bromo-2H-benzotriazole.
What is the InChI of 5-Bromo-1H-benzotriazole?
The InChI is InChI=1S/C6H4BrN3/c7-4-1-2-5-6(3-4)9-10-8-5/h1-3H,(H,8,9,10).
What is the InChIKey of 5-Bromo-1H-benzotriazole?
The InChIKey is BQCIJWPKDPZNHD-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Bromo-1H-benzotriazole?
The canonical SMILES is C1=CC2=NNN=C2C=C1Br.
What is the CAS number of 5-Bromo-1H-benzotriazole?
The CAS number is 32046-62-1.
What is the European Community (EC) Number of 5-Bromo-1H-benzotriazole?
The European Community (EC) Number is 813-000-8.
What is the DSSTox Substance ID of 5-Bromo-1H-benzotriazole?
The DSSTox Substance ID is DTXSID10423286.
Is 5-Bromo-1H-benzotriazole a canonicalized compound?
Yes, 5-Bromo-1H-benzotriazole is a canonicalized compound.