What is the molecular formula of 4-Fluorobenzyl chloride?
The molecular formula of 4-Fluorobenzyl chloride is C7H6ClF.
What is the molecular weight of 4-Fluorobenzyl chloride?
The molecular weight of 4-Fluorobenzyl chloride is 144.57 g/mol.
What is the IUPAC name of 4-Fluorobenzyl chloride?
The IUPAC name of 4-Fluorobenzyl chloride is 1-(chloromethyl)-4-fluorobenzene.
What is the InChI of 4-Fluorobenzyl chloride?
The InChI of 4-Fluorobenzyl chloride is InChI=1S/C7H6ClF/c8-5-6-1-3-7(9)4-2-6/h1-4H,5H2.
What is the InChIKey of 4-Fluorobenzyl chloride?
The InChIKey of 4-Fluorobenzyl chloride is IZXWCDITFDNEBY-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Fluorobenzyl chloride?
The canonical SMILES of 4-Fluorobenzyl chloride is C1=CC(=CC=C1CCl)F.
What is the CAS number of 4-Fluorobenzyl chloride?
The CAS number of 4-Fluorobenzyl chloride is 352-11-4.
What is the European Community (EC) number of 4-Fluorobenzyl chloride?
The European Community (EC) number of 4-Fluorobenzyl chloride is 206-516-4.
What is the DSSTox Substance ID of 4-Fluorobenzyl chloride?
The DSSTox Substance ID of 4-Fluorobenzyl chloride is DTXSID7059850.
Is 4-Fluorobenzyl chloride a compound with defined bond stereocenter count?
No, 4-Fluorobenzyl chloride does not have a defined bond stereocenter count.