What is the chemical formula of 2-Fluorobenzyl chloride?
The chemical formula of 2-Fluorobenzyl chloride is C7H6ClF.
What is the molecular weight of 2-Fluorobenzyl chloride?
The molecular weight of 2-Fluorobenzyl chloride is 144.57 g/mol.
What is the IUPAC name of 2-Fluorobenzyl chloride?
The IUPAC name of 2-Fluorobenzyl chloride is 1-(chloromethyl)-2-fluorobenzene.
What is the InChI of 2-Fluorobenzyl chloride?
The InChI of 2-Fluorobenzyl chloride is InChI=1S/C7H6ClF/c8-5-6-3-1-2-4-7(6)9/h1-4H,5H2.
What is the InChIKey of 2-Fluorobenzyl chloride?
The InChIKey of 2-Fluorobenzyl chloride is MOBRMRJUKNQBMY-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Fluorobenzyl chloride?
The canonical SMILES of 2-Fluorobenzyl chloride is C1=CC=C(C(=C1)CCl)F.
What is the CAS number of 2-Fluorobenzyl chloride?
The CAS number of 2-Fluorobenzyl chloride is 345-35-7.
What is the European Community (EC) number of 2-Fluorobenzyl chloride?
The European Community (EC) number of 2-Fluorobenzyl chloride is 206-460-0.
What is the molecular weight of 2-Fluorobenzyl chloride according to PubChem?
The molecular weight of 2-Fluorobenzyl chloride is 144.57 g/mol according to PubChem.
Is the compound is canonicalized according to PubChem?
Yes, the compound is canonicalized according to PubChem.