What is the molecular formula of 4-Ethynyl-phenol?
The molecular formula is C8H6O.
What are some synonyms of 4-Ethynyl-phenol?
Some synonyms include 4-ethynylphenol, 2200-91-1, 4-ethynyl-phenol, and 4-Hydroxyphenylacetylene.
What is the molecular weight of 4-Ethynyl-phenol?
The molecular weight is 118.13 g/mol.
When was 4-Ethynyl-phenol created?
It was created on August 8, 2005.
When was 4-Ethynyl-phenol last modified?
It was last modified on October 21, 2023.
What is the IUPAC name of 4-Ethynyl-phenol?
The IUPAC name is 4-ethynylphenol.
What is the InChI of 4-Ethynyl-phenol?
The InChI is InChI=1S/C8H6O/c1-2-7-3-5-8(9)6-4-7/h1,3-6,9H.
What is the InChIKey of 4-Ethynyl-phenol?
The InChIKey is HLXJEKPLQLVJGK-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Ethynyl-phenol?
The canonical SMILES is C#CC1=CC=C(C=C1)O.
What is the CAS number of 4-Ethynyl-phenol?
The CAS number is 2200-91-1.