What is the PubChem CID of 4-Bromopicolinonitrile?
PubChem CID: 693283
What is the molecular formula of 4-Bromopicolinonitrile?
Molecular Formula: C6H3BrN2
What is the molecular weight of 4-Bromopicolinonitrile?
Molecular Weight: 183.01 g/mol
What is the IUPAC name of 4-Bromopicolinonitrile?
IUPAC Name: 4-bromopyridine-2-carbonitrile
What is the InChI of 4-Bromopicolinonitrile?
InChI: InChI=1S/C6H3BrN2/c7-5-1-2-9-6(3-5)4-8/h1-3H
What is the InChIKey of 4-Bromopicolinonitrile?
InChIKey: CZXDCTUSFIKLIJ-UHFFFAOYSA-N
What is the Canonical SMILES of 4-Bromopicolinonitrile?
Canonical SMILES: C1=CN=C(C=C1Br)C#N
What is the CAS number of 4-Bromopicolinonitrile?
CAS Number: 62150-45-2
What is the European Community (EC) number of 4-Bromopicolinonitrile?
EC Number: 688-035-3
Is 4-Bromopicolinonitrile a canonicalized compound?
Yes, the compound is canonicalized.