What is the molecular formula of 5-Bromo-2-methoxy-isonicotinic acid?
The molecular formula is C7H6BrNO3.
What are the synonyms of 5-Bromo-2-methoxy-isonicotinic acid?
The synonyms are 886365-22-6, 5-bromo-2-methoxyisonicotinic acid, 5-BROMO-2-METHOXY-ISONICOTINIC ACID, and 5-BROMO-2-METHOXYPYRIDINE-4-CARBOXYLIC ACID.
What is the molecular weight of 5-Bromo-2-methoxy-isonicotinic acid?
The molecular weight is 232.03 g/mol.
When was 5-Bromo-2-methoxy-isonicotinic acid created?
It was created on July 12, 2012.
What is the IUPAC name of 5-Bromo-2-methoxy-isonicotinic acid?
The IUPAC name is 5-bromo-2-methoxypyridine-4-carboxylic acid.
What is the InChI of 5-Bromo-2-methoxy-isonicotinic acid?
The InChI is InChI=1S/C7H6BrNO3/c1-12-6-2-4(7(10)11)5(8)3-9-6/h2-3H,1H3,(H,10,11).
What is the InChIKey of 5-Bromo-2-methoxy-isonicotinic acid?
The InChIKey is JZBHBRMXZANNNF-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Bromo-2-methoxy-isonicotinic acid?
The canonical SMILES is COC1=NC=C(C(=C1)C(=O)O)Br.
What is the XLogP3-AA value of 5-Bromo-2-methoxy-isonicotinic acid?
The XLogP3-AA value is 1.4.
Is 5-Bromo-2-methoxy-isonicotinic acid a canonicalized compound?
Yes, it is a canonicalized compound.
※ Please kindly note that our products are for research use only.