What is the PubChem CID of 4-Bromo-D-phenylalanine?
The PubChem CID of 4-Bromo-D-phenylalanine is 671215.
What is the molecular formula of 4-Bromo-D-phenylalanine?
The molecular formula of 4-Bromo-D-phenylalanine is C9H10BrNO2.
What is the molecular weight of 4-Bromo-D-phenylalanine?
The molecular weight of 4-Bromo-D-phenylalanine is 244.08 g/mol.
What is the IUPAC name of 4-Bromo-D-phenylalanine?
The IUPAC name of 4-Bromo-D-phenylalanine is (2R)-2-amino-3-(4-bromophenyl)propanoic acid.
What is the InChI of 4-Bromo-D-phenylalanine?
The InChI of 4-Bromo-D-phenylalanine is InChI=1S/C9H10BrNO2/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,8H,5,11H2,(H,12,13)/t8-/m1/s1.
What is the InChIKey of 4-Bromo-D-phenylalanine?
The InChIKey of 4-Bromo-D-phenylalanine is PEMUHKUIQHFMTH-MRVPVSSYSA-N.
What is the canonical SMILES of 4-Bromo-D-phenylalanine?
The canonical SMILES of 4-Bromo-D-phenylalanine is C1=CC(=CC=C1CC(C(=O)O)N)Br.
What is the isomeric SMILES of 4-Bromo-D-phenylalanine?
The isomeric SMILES of 4-Bromo-D-phenylalanine is C1=CC(=CC=C1C[C@H](C(=O)O)N)Br.
What is the CAS number of 4-Bromo-D-phenylalanine?
The CAS number of 4-Bromo-D-phenylalanine is 62561-74-4.
What is the European Community (EC) number of 4-Bromo-D-phenylalanine?
The European Community (EC) number of 4-Bromo-D-phenylalanine is 818-023-7.