What is the molecular formula of 2-Bromo-3-butoxypyridine?
The molecular formula of 2-Bromo-3-butoxypyridine is C9H12BrNO.
What is the molecular weight of 2-Bromo-3-butoxypyridine?
The molecular weight of 2-Bromo-3-butoxypyridine is 230.10 g/mol.
What is the IUPAC name of 2-Bromo-3-butoxypyridine?
The IUPAC name of 2-Bromo-3-butoxypyridine is 2-bromo-3-butoxypyridine.
What is the InChI of 2-Bromo-3-butoxypyridine?
The InChI of 2-Bromo-3-butoxypyridine is InChI=1S/C9H12BrNO/c1-2-3-7-12-8-5-4-6-11-9(8)10/h4-6H,2-3,7H2,1H3.
What is the InChIKey of 2-Bromo-3-butoxypyridine?
The InChIKey of 2-Bromo-3-butoxypyridine is IEDZCTRHPPDOSX-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-3-butoxypyridine?
The canonical SMILES of 2-Bromo-3-butoxypyridine is CCCCOC1=C(N=CC=C1)Br.
What is the CAS number of 2-Bromo-3-butoxypyridine?
The CAS number of 2-Bromo-3-butoxypyridine is 936033-56-6.
What is the XLogP3-AA value of 2-Bromo-3-butoxypyridine?
The XLogP3-AA value of 2-Bromo-3-butoxypyridine is 3.1.
How many hydrogen bond donor counts does 2-Bromo-3-butoxypyridine have?
2-Bromo-3-butoxypyridine has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2-Bromo-3-butoxypyridine have?
2-Bromo-3-butoxypyridine has 2 hydrogen bond acceptor counts.