What is the molecular formula of 4-Bromo-2-nitroaniline?
The molecular formula of 4-Bromo-2-nitroaniline is C6H5BrN2O2.
What is the molecular weight of 4-Bromo-2-nitroaniline?
The molecular weight of 4-Bromo-2-nitroaniline is 217.02 g/mol.
What is the IUPAC name of 4-Bromo-2-nitroaniline?
The IUPAC name of 4-Bromo-2-nitroaniline is 4-bromo-2-nitroaniline.
What is the InChI of 4-Bromo-2-nitroaniline?
The InChI of 4-Bromo-2-nitroaniline is "InChI=1S/C6H5BrN2O2/c7-4-1-2-5(8)6(3-4)9(10)11/h1-3H,8H2".
What is the InChIKey of 4-Bromo-2-nitroaniline?
The InChIKey of 4-Bromo-2-nitroaniline is "ZCWBZRBJSPWUPG-UHFFFAOYSA-N".
What is the canonical SMILES of 4-Bromo-2-nitroaniline?
The canonical SMILES of 4-Bromo-2-nitroaniline is "C1=CC(=C(C=C1Br)[N+](=O)[O-])N".
What is the CAS number of 4-Bromo-2-nitroaniline?
The CAS number of 4-Bromo-2-nitroaniline is 875-51-4.
What is the European Community (EC) number of 4-Bromo-2-nitroaniline?
The European Community (EC) number of 4-Bromo-2-nitroaniline is 629-579-3.
What is the DSSTox Substance ID of 4-Bromo-2-nitroaniline?
The DSSTox Substance ID of 4-Bromo-2-nitroaniline is DTXSID0061248.
Is 4-Bromo-2-nitroaniline a canonicalized compound?
Yes, 4-Bromo-2-nitroaniline is a canonicalized compound.