What is the molecular formula of 4-Bromo-3-cyanopyridine?
The molecular formula of 4-Bromo-3-cyanopyridine is C6H3BrN2.
What is the molecular weight of 4-Bromo-3-cyanopyridine?
The molecular weight of 4-Bromo-3-cyanopyridine is 183.01 g/mol.
What is the IUPAC name of 4-Bromo-3-cyanopyridine?
The IUPAC name of 4-Bromo-3-cyanopyridine is 4-bromopyridine-3-carbonitrile.
What is the InChI of 4-Bromo-3-cyanopyridine?
The InChI of 4-Bromo-3-cyanopyridine is InChI=1S/C6H3BrN2/c7-6-1-2-9-4-5(6)3-8/h1-2,4H.
What is the InChIKey of 4-Bromo-3-cyanopyridine?
The InChIKey of 4-Bromo-3-cyanopyridine is DMQBJRMKGVMOHX-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromo-3-cyanopyridine?
The canonical SMILES of 4-Bromo-3-cyanopyridine is C1=CN=CC(=C1Br)C#N.
What is the CAS number of 4-Bromo-3-cyanopyridine?
The CAS number of 4-Bromo-3-cyanopyridine is 154237-70-4.
What is the European Community (EC) number of 4-Bromo-3-cyanopyridine?
The European Community (EC) number of 4-Bromo-3-cyanopyridine is 640-748-0.
Is 4-Bromo-3-cyanopyridine a canonicalized compound?
Yes, 4-Bromo-3-cyanopyridine is a canonicalized compound.