What is the molecular formula of 4-Bromo-1-indanol?
The molecular formula of 4-Bromo-1-indanol is C9H9BrO.
What is the molecular weight of 4-Bromo-1-indanol?
The molecular weight of 4-Bromo-1-indanol is 213.07 g/mol.
What is the IUPAC name of 4-Bromo-1-indanol?
The IUPAC name of 4-Bromo-1-indanol is 4-bromo-2,3-dihydro-1H-inden-1-ol.
What is the InChI of 4-Bromo-1-indanol?
The InChI of 4-Bromo-1-indanol is InChI=1S/C9H9BrO/c10-8-3-1-2-7-6(8)4-5-9(7)11/h1-3,9,11H,4-5H2.
What is the InChIKey of 4-Bromo-1-indanol?
The InChIKey of 4-Bromo-1-indanol is RNXQQZNOSYBFTN-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromo-1-indanol?
The canonical SMILES of 4-Bromo-1-indanol is C1CC2=C(C1O)C=CC=C2Br.
What is the CAS number of 4-Bromo-1-indanol?
The CAS number of 4-Bromo-1-indanol is 16657-10-6.
What is the European Community (EC) number of 4-Bromo-1-indanol?
The European Community (EC) number of 4-Bromo-1-indanol is 663-018-3.
What is the hydrogen bond donor count of 4-Bromo-1-indanol?
The hydrogen bond donor count of 4-Bromo-1-indanol is 1.
What is the hydrogen bond acceptor count of 4-Bromo-1-indanol?
The hydrogen bond acceptor count of 4-Bromo-1-indanol is 1.