What is the molecular formula of 1,4-dioctylbenzene?
The molecular formula of 1,4-dioctylbenzene is C22H38.
What is the molecular weight of 1,4-dioctylbenzene?
The molecular weight of 1,4-dioctylbenzene is 302.5 g/mol.
What is the IUPAC name of 1,4-dioctylbenzene?
The IUPAC name of 1,4-dioctylbenzene is 1,4-dioctylbenzene.
What is the InChI of 1,4-dioctylbenzene?
The InChI of 1,4-dioctylbenzene is InChI=1S/C22H38/c1-3-5-7-9-11-13-15-21-17-19-22(20-18-21)16-14-12-10-8-6-4-2/h17-20H,3-16H2,1-2H3.
What is the InChIKey of 1,4-dioctylbenzene?
The InChIKey of 1,4-dioctylbenzene is WNLMYIPOMNQVLC-UHFFFAOYSA-N.
What is the canonical SMILES of 1,4-dioctylbenzene?
The canonical SMILES of 1,4-dioctylbenzene is CCCCCCCCC1=CC=C(C=C1)CCCCCCCC.
What is the CAS number of 1,4-dioctylbenzene?
The CAS number of 1,4-dioctylbenzene is 10541-38-5.
What is the EC number of 1,4-dioctylbenzene?
The EC number of 1,4-dioctylbenzene is 623-380-5.
What is the DTXSID of 1,4-dioctylbenzene?
The DTXSID of 1,4-dioctylbenzene is DTXSID70453600.
Is 1,4-dioctylbenzene a canonicalized compound?
Yes, 1,4-dioctylbenzene is a canonicalized compound.