What is the molecular formula of Pyrene?
The molecular formula of Pyrene is C16H10.
What is the molecular weight of Pyrene?
The molecular weight of Pyrene is 202.25 g/mol.
What is the IUPAC name of Pyrene?
The IUPAC name of Pyrene is pyrene.
What is the InChI of Pyrene?
The InChI of Pyrene is InChI=1S/C16H10/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14/h1-10H.
What is the InChIKey of Pyrene?
The InChIKey of Pyrene is BBEAQIROQSPTKN-UHFFFAOYSA-N.
What is the canonical SMILES of Pyrene?
The canonical SMILES of Pyrene is C1=CC2=C3C(=C1)C=CC4=CC=CC(=C43)C=C2.
What is the CAS number of Pyrene?
The CAS number of Pyrene is 129-00-0.
Does Pyrene have a hydrogen bond donor count?
No, Pyrene does not have a hydrogen bond donor count.
Does Pyrene have a hydrogen bond acceptor count?
No, Pyrene does not have a hydrogen bond acceptor count.
What is the XLogP3 value of Pyrene?
The XLogP3 value of Pyrene is 4.9.