What is the molecular formula of 4-Amino-2-phenylphenol?
The molecular formula is C12H11NO.
What is the molecular weight of 4-Amino-2-phenylphenol?
The molecular weight is 185.22 g/mol.
What is the IUPAC name of 4-Amino-2-phenylphenol?
The IUPAC name is 4-amino-2-phenylphenol.
What is the InChI of 4-Amino-2-phenylphenol?
The InChI is InChI=1S/C12H11NO/c13-10-6-7-12(14)11(8-10)9-4-2-1-3-5-9/h1-8,14H,13H2.
What is the InChIKey of 4-Amino-2-phenylphenol?
The InChIKey is OUIITAOCYATDMY-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Amino-2-phenylphenol?
The canonical SMILES is C1=CC=C(C=C1)C2=C(C=CC(=C2)N)O.
What is the CAS number of 4-Amino-2-phenylphenol?
The CAS number is 19434-42-5.
What is the European Community (EC) number of 4-Amino-2-phenylphenol?
The EC number is 827-413-6.
What is the DSSTox Substance ID of 4-Amino-2-phenylphenol?
The DSSTox Substance ID is DTXSID70173058.
What is the XLogP3 value of 4-Amino-2-phenylphenol?
The XLogP3 value is 2.9.