What is the molecular formula of 1-phenyloctan-1-ol?
The molecular formula of 1-phenyloctan-1-ol is C14H22O.
What are the synonyms for 1-phenyloctan-1-ol?
The synonyms for 1-phenyloctan-1-ol are 1-PHENYL-1-OCTANOL and Benzenemethanol, a-heptyl-.
What is the molecular weight of 1-phenyloctan-1-ol?
The molecular weight of 1-phenyloctan-1-ol is 206.32 g/mol.
When was 1-phenyloctan-1-ol created?
1-phenyloctan-1-ol was created on July 19, 2005.
What is the IUPAC name of 1-phenyloctan-1-ol?
The IUPAC name of 1-phenyloctan-1-ol is 1-phenyloctan-1-ol.
What is the InChI of 1-phenyloctan-1-ol?
The InChI of 1-phenyloctan-1-ol is InChI=1S/C14H22O/c1-2-3-4-5-9-12-14(15)13-10-7-6-8-11-13/h6-8,10-11,14-15H,2-5,9,12H2,1H3.
What is the InChIKey of 1-phenyloctan-1-ol?
The InChIKey of 1-phenyloctan-1-ol is MNBCPXKENXMEEJ-UHFFFAOYSA-N.
What is the Canonical SMILES of 1-phenyloctan-1-ol?
The Canonical SMILES of 1-phenyloctan-1-ol is CCCCCCCC(C1=CC=CC=C1)O.
What is the CAS number of 1-phenyloctan-1-ol?
The CAS number of 1-phenyloctan-1-ol is 19396-73-7.
What is the XLogP3-AA value of 1-phenyloctan-1-ol?
The XLogP3-AA value of 1-phenyloctan-1-ol is 4.5.