What is the molecular formula of 4,4-Bis(diethylamino)benzophenone?
The molecular formula of 4,4-Bis(diethylamino)benzophenone is C21H28N2O.
What is the molecular weight of 4,4-Bis(diethylamino)benzophenone?
The molecular weight of 4,4-Bis(diethylamino)benzophenone is 324.5 g/mol.
What is the IUPAC name of 4,4-Bis(diethylamino)benzophenone?
The IUPAC name of 4,4-Bis(diethylamino)benzophenone is bis[4-(diethylamino)phenyl]methanone.
What is the InChI of 4,4-Bis(diethylamino)benzophenone?
The InChI of 4,4-Bis(diethylamino)benzophenone is InChI=1S/C21H28N2O/c1-5-22(6-2)19-13-9-17(10-14-19)21(24)18-11-15-20(16-12-18)23(7-3)8-4/h9-16H,5-8H2,1-4H3.
What is the InChIKey of 4,4-Bis(diethylamino)benzophenone?
The InChIKey of 4,4-Bis(diethylamino)benzophenone is VYHBFRJRBHMIQZ-UHFFFAOYSA-N.
What is the synonyms of 4,4-Bis(diethylamino)benzophenone?
The synonyms of 4,4-Bis(diethylamino)benzophenone are Michler's ethyl ketone, 4,4'-Bis(diethylamino) benzophenone, and Bis(4-(diethylamino)phenyl)methanone.
What is the CAS number of 4,4-Bis(diethylamino)benzophenone?
The CAS number of 4,4-Bis(diethylamino)benzophenone is 90-93-7.
What is the XLogP3 value of 4,4-Bis(diethylamino)benzophenone?
The XLogP3 value of 4,4-Bis(diethylamino)benzophenone is 5.3.
What is the hydrogen bond donor count of 4,4-Bis(diethylamino)benzophenone?
The hydrogen bond donor count of 4,4-Bis(diethylamino)benzophenone is 0.
Is 4,4-Bis(diethylamino)benzophenone a canonicalized compound?
Yes, 4,4-Bis(diethylamino)benzophenone is a canonicalized compound.
※ Please kindly note that our products are for research use only.