What is the molecular formula of 3-Fluorobenzyl chloride?
The molecular formula of 3-Fluorobenzyl chloride is C7H6ClF.
What is the molecular weight of 3-Fluorobenzyl chloride?
The molecular weight of 3-Fluorobenzyl chloride is 144.57 g/mol.
What is the IUPAC name of 3-Fluorobenzyl chloride?
The IUPAC name of 3-Fluorobenzyl chloride is 1-(chloromethyl)-3-fluorobenzene.
What is the InChI of 3-Fluorobenzyl chloride?
The InChI of 3-Fluorobenzyl chloride is InChI=1S/C7H6ClF/c8-5-6-2-1-3-7(9)4-6/h1-4H,5H2.
What is the InChIKey of 3-Fluorobenzyl chloride?
The InChIKey of 3-Fluorobenzyl chloride is XBDXMDVEZLOGMC-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Fluorobenzyl chloride?
The canonical SMILES of 3-Fluorobenzyl chloride is C1=CC(=CC(=C1)F)CCl.
What is the CAS number of 3-Fluorobenzyl chloride?
The CAS number of 3-Fluorobenzyl chloride is 456-42-8.
What are the computed properties of 3-Fluorobenzyl chloride?
The computed properties of 3-Fluorobenzyl chloride include molecular weight, XLogP3, hydrogen bond donor count, hydrogen bond acceptor count, rotatable bond count, exact mass, monoisotopic mass, topological polar surface area, heavy atom count, formal charge, complexity, isotope atom count, defined atom stereocenter count, undefined atom stereocenter count, defined bond stereocenter count, undefined bond stereocenter count, covalently-bonded unit count, and whether the compound is canonicalized.
What is the complexity of 3-Fluorobenzyl chloride?
The complexity of 3-Fluorobenzyl chloride is 85.
Is 3-Fluorobenzyl chloride a canonicalized compound?
Yes, 3-Fluorobenzyl chloride is a canonicalized compound.