What is the molecular formula of 3-Iodobenzyl bromide?
The molecular formula of 3-Iodobenzyl bromide is C7H6BrI.
What is the molecular weight of 3-Iodobenzyl bromide?
The molecular weight of 3-Iodobenzyl bromide is 296.93 g/mol.
What is the IUPAC name of 3-Iodobenzyl bromide?
The IUPAC name of 3-Iodobenzyl bromide is 1-(bromomethyl)-3-iodobenzene.
What is the InChI of 3-Iodobenzyl bromide?
The InChI of 3-Iodobenzyl bromide is InChI=1S/C7H6BrI/c8-5-6-2-1-3-7(9)4-6/h1-4H,5H2.
What is the InChIKey of 3-Iodobenzyl bromide?
The InChIKey of 3-Iodobenzyl bromide is BACZSVQZBSCWIG-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Iodobenzyl bromide?
The canonical SMILES of 3-Iodobenzyl bromide is C1=CC(=CC(=C1)I)CBr.
What is the CAS number of 3-Iodobenzyl bromide?
The CAS number of 3-Iodobenzyl bromide is 49617-83-6.
What is the European Community (EC) number of 3-Iodobenzyl bromide?
The European Community (EC) number of 3-Iodobenzyl bromide is 628-893-8.
Is 3-Iodobenzyl bromide a canonicalized compound?
Yes, 3-Iodobenzyl bromide is a canonicalized compound.