What is the molecular formula of 2-(Benzyloxy)phenol?
The molecular formula of 2-(Benzyloxy)phenol is C13H12O2.
What is the molecular weight of 2-(Benzyloxy)phenol?
The molecular weight of 2-(Benzyloxy)phenol is 200.23 g/mol.
What is the IUPAC name of 2-(Benzyloxy)phenol?
The IUPAC name of 2-(Benzyloxy)phenol is 2-phenylmethoxyphenol.
What is the InChI of 2-(Benzyloxy)phenol?
The InChI of 2-(Benzyloxy)phenol is InChI=1S/C13H12O2/c14-12-8-4-5-9-13(12)15-10-11-6-2-1-3-7-11/h1-9,14H,10H2.
What is the InChIKey of 2-(Benzyloxy)phenol?
The InChIKey of 2-(Benzyloxy)phenol is CCZCXFHJMKINPE-UHFFFAOYSA-N.
What is the canonical SMILES of 2-(Benzyloxy)phenol?
The canonical SMILES of 2-(Benzyloxy)phenol is C1=CC=C(C=C1)COC2=CC=CC=C2O.
What is the CAS number of 2-(Benzyloxy)phenol?
The CAS number of 2-(Benzyloxy)phenol is 6272-38-4.
What is the European Community (EC) number of 2-(Benzyloxy)phenol?
The European Community (EC) number of 2-(Benzyloxy)phenol is 228-461-5.
What is the ChEMBL ID of 2-(Benzyloxy)phenol?
The ChEMBL ID of 2-(Benzyloxy)phenol is CHEMBL4442258.
Is 2-(Benzyloxy)phenol considered a canonicalized compound?
Yes, 2-(Benzyloxy)phenol is considered a canonicalized compound.