What is the molecular formula of 1,3-Diiodobenzene?
The molecular formula of 1,3-Diiodobenzene is C6H4I2.
What is the molecular weight of 1,3-Diiodobenzene?
The molecular weight of 1,3-Diiodobenzene is 329.90 g/mol.
What is the IUPAC name of 1,3-Diiodobenzene?
The IUPAC name of 1,3-Diiodobenzene is 1,3-diiodobenzene.
What is the InChI of 1,3-Diiodobenzene?
The InChI of 1,3-Diiodobenzene is InChI=1S/C6H4I2/c7-5-2-1-3-6(8)4-5/h1-4H.
What is the InChIKey of 1,3-Diiodobenzene?
The InChIKey of 1,3-Diiodobenzene is SFPQFQUXAJOWNF-UHFFFAOYSA-N.
What is the canonical SMILES of 1,3-Diiodobenzene?
The canonical SMILES of 1,3-Diiodobenzene is C1=CC(=CC(=C1)I)I.
What is the CAS number of 1,3-Diiodobenzene?
The CAS number of 1,3-Diiodobenzene is 626-00-6.
What is the European Community (EC) number of 1,3-Diiodobenzene?
The European Community (EC) number of 1,3-Diiodobenzene is 210-921-1.
What is the UNII of 1,3-Diiodobenzene?
The UNII of 1,3-Diiodobenzene is EYA3RT2SVY.
What is the XLogP3-AA value of 1,3-Diiodobenzene?
The XLogP3-AA value of 1,3-Diiodobenzene is 3.2.