What is the molecular formula of 2,7-Dibromofluorene?
The molecular formula of 2,7-Dibromofluorene is C13H8Br2.
What is the molecular weight of 2,7-Dibromofluorene?
The molecular weight of 2,7-Dibromofluorene is 324.01 g/mol.
What is the IUPAC name of 2,7-Dibromofluorene?
The IUPAC name of 2,7-Dibromofluorene is 2,7-dibromo-9H-fluorene.
What is the InChI of 2,7-Dibromofluorene?
The InChI of 2,7-Dibromofluorene is InChI=1S/C13H8Br2/c14-10-1-3-12-8(6-10)5-9-7-11(15)2-4-13(9)12/h1-4,6-7H,5H2.
What is the InChIKey of 2,7-Dibromofluorene?
The InChIKey of 2,7-Dibromofluorene is AVXFJPFSWLMKSG-UHFFFAOYSA-N.
What is the canonical SMILES of 2,7-Dibromofluorene?
The canonical SMILES of 2,7-Dibromofluorene is C1C2=C(C=CC(=C2)Br)C3=C1C=C(C=C3)Br.
What is the CAS number of 2,7-Dibromofluorene?
The CAS number of 2,7-Dibromofluorene is 16433-88-8.
What is the European Community (EC) number of 2,7-Dibromofluorene?
The European Community (EC) number of 2,7-Dibromofluorene is 629-430-2.
What is the DSSTox Substance ID of 2,7-Dibromofluorene?
The DSSTox Substance ID of 2,7-Dibromofluorene is DTXSID60167744.
Is 2,7-Dibromofluorene a covalently-bonded unit?
Yes, 2,7-Dibromofluorene is a covalently-bonded unit.