What is the PubChem CID for N-Acetylethanolamine?
PubChem CID 8880.
What is the molecular formula of N-Acetylethanolamine?
The molecular formula is C4H9NO2.
What are the synonyms for N-Acetylethanolamine?
The synonyms for N-Acetylethanolamine are N-(2-Hydroxyethyl)acetamide, 2-Acetamidoethanol, Acetamide, N-(2-hydroxyethyl), and more.
What is the molecular weight of N-Acetylethanolamine?
The molecular weight is 103.12 g/mol.
What is the IUPAC name of N-Acetylethanolamine?
The IUPAC name is N-(2-hydroxyethyl)acetamide.
What is the InChI of N-Acetylethanolamine?
The InChI is InChI=1S/C4H9NO2/c1-4(7)5-2-3-6/h6H,2-3H2,1H3,(H,5,7).
What is the InChIKey of N-Acetylethanolamine?
The InChIKey is PVCJKHHOXFKFRP-UHFFFAOYSA-N.
What is the canonical SMILES of N-Acetylethanolamine?
The canonical SMILES is CC(=O)NCCO.
What is the CAS number of N-Acetylethanolamine?
The CAS number is 142-26-7.
What is the European Community (EC) number of N-Acetylethanolamine?
The EC number is 205-530-8.