What is the chemical formula of 2,4-Dichloroiodobenzene?
The chemical formula of 2,4-Dichloroiodobenzene is C6H3Cl2I.
What are the synonyms of 2,4-Dichloroiodobenzene?
The synonyms of 2,4-Dichloroiodobenzene are 2,4-Dichloro-1-iodobenzene, 29898-32-6, 1,3-Dichloro-4-iodobenzene, and Benzene, 2,4-dichloro-1-iodo-.
What is the molecular weight of 2,4-Dichloroiodobenzene?
The molecular weight of 2,4-Dichloroiodobenzene is 272.89 g/mol.
What is the IUPAC name of 2,4-Dichloroiodobenzene?
The IUPAC name of 2,4-Dichloroiodobenzene is 2,4-dichloro-1-iodobenzene.
What is the InChI of 2,4-Dichloroiodobenzene?
The InChI of 2,4-Dichloroiodobenzene is InChI=1S/C6H3Cl2I/c7-4-1-2-6(9)5(8)3-4/h1-3H.
What is the InChIKey of 2,4-Dichloroiodobenzene?
The InChIKey of 2,4-Dichloroiodobenzene is ZQKJCBDCOGLKCQ-UHFFFAOYSA-N.
What is the canonical SMILES of 2,4-Dichloroiodobenzene?
The canonical SMILES of 2,4-Dichloroiodobenzene is C1=CC(=C(C=C1Cl)Cl)I.
What is the CAS number of 2,4-Dichloroiodobenzene?
The CAS number of 2,4-Dichloroiodobenzene is 29898-32-6.
Is 2,4-Dichloroiodobenzene a canonicalized compound?
Yes, 2,4-Dichloroiodobenzene is a canonicalized compound.