What is the molecular formula of 1-(Bromomethyl)pyrene?
The molecular formula of 1-(Bromomethyl)pyrene is C17H11Br.
What is the molecular weight of 1-(Bromomethyl)pyrene?
The molecular weight of 1-(Bromomethyl)pyrene is 295.2 g/mol.
What is the CAS number of 1-(Bromomethyl)pyrene?
The CAS number of 1-(Bromomethyl)pyrene is 2595-90-6.
What is the InChI of 1-(Bromomethyl)pyrene?
The InChI of 1-(Bromomethyl)pyrene is InChI=1S/C17H11Br/c18-10-14-7-6-13-5-4-11-2-1-3-12-8-9-15(14)17(13)16(11)12/h1-9H,10H2.
What is the InChIKey of 1-(Bromomethyl)pyrene?
The InChIKey of 1-(Bromomethyl)pyrene is UGMXRPVWWWDPFC-UHFFFAOYSA-N.
What is the XLogP3-AA value of 1-(Bromomethyl)pyrene?
The XLogP3-AA value of 1-(Bromomethyl)pyrene is 5.6.
How many hydrogen bond donor counts does 1-(Bromomethyl)pyrene have?
1-(Bromomethyl)pyrene does not have any hydrogen bond donor count (0).
How many rotatable bond counts does 1-(Bromomethyl)pyrene have?
1-(Bromomethyl)pyrene has 1 rotatable bond count.
What is the topological polar surface area of 1-(Bromomethyl)pyrene?
The topological polar surface area of 1-(Bromomethyl)pyrene is 0Ų.
Is 1-(Bromomethyl)pyrene a canonicalized compound?
Yes, 1-(Bromomethyl)pyrene is a canonicalized compound.