What is the molecular formula of 2,3-Dibromo-6-picoline?
The molecular formula of 2,3-Dibromo-6-picoline is C6H5Br2N.
What is the molecular weight of 2,3-Dibromo-6-picoline?
The molecular weight of 2,3-Dibromo-6-picoline is 250.92 g/mol.
What is the IUPAC name of 2,3-Dibromo-6-picoline?
The IUPAC name of 2,3-Dibromo-6-picoline is 2,3-dibromo-6-methylpyridine.
What is the InChI of 2,3-Dibromo-6-picoline?
The InChI of 2,3-Dibromo-6-picoline is InChI=1S/C6H5Br2N/c1-4-2-3-5(7)6(8)9-4/h2-3H,1H3.
What is the InChIKey of 2,3-Dibromo-6-picoline?
The InChIKey of 2,3-Dibromo-6-picoline is BEAADMGNHFDPOM-UHFFFAOYSA-N.
What is the Canonical SMILES of 2,3-Dibromo-6-picoline?
The Canonical SMILES of 2,3-Dibromo-6-picoline is CC1=NC(=C(C=C1)Br)Br.
What is the CAS number of 2,3-Dibromo-6-picoline?
The CAS number of 2,3-Dibromo-6-picoline is 261373-04-0.
What is the XLogP3-AA value of 2,3-Dibromo-6-picoline?
The XLogP3-AA value of 2,3-Dibromo-6-picoline is 3.
How many hydrogen bond donor counts does 2,3-Dibromo-6-picoline have?
2,3-Dibromo-6-picoline does not have any hydrogen bond donor count.
How many hydrogen bond acceptor counts does 2,3-Dibromo-6-picoline have?
2,3-Dibromo-6-picoline has 1 hydrogen bond acceptor count.