What is the molecular formula of (R)-N-BOC-3-Bromophenylalanine?
The molecular formula of (R)-N-BOC-3-Bromophenylalanine is C14H18BrNO4.
What is the molecular weight of (R)-N-BOC-3-Bromophenylalanine?
The molecular weight of (R)-N-BOC-3-Bromophenylalanine is 344.20 g/mol.
What is the IUPAC name of (R)-N-BOC-3-Bromophenylalanine?
The IUPAC name of (R)-N-BOC-3-Bromophenylalanine is (2R)-3-(3-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
What is the InChI of (R)-N-BOC-3-Bromophenylalanine?
The InChI of (R)-N-BOC-3-Bromophenylalanine is InChI=1S/C14H18BrNO4/c1-14(2,3)20-13(19)16-11(12(17)18)8-9-5-4-6-10(15)7-9/h4-7,11H,8H2,1-3H3,(H,16,19)(H,17,18)/t11-/m1/s1.
What is the InChIKey of (R)-N-BOC-3-Bromophenylalanine?
The InChIKey of (R)-N-BOC-3-Bromophenylalanine is FBUDYESOPLBQIR-LLVKDONJSA-N.
What is the canonical SMILES of (R)-N-BOC-3-Bromophenylalanine?
The canonical SMILES of (R)-N-BOC-3-Bromophenylalanine is CC(C)(C)OC(=O)NC(CC1=CC(=CC=C1)Br)C(=O)O.
What is the XLogP3-AA value of (R)-N-BOC-3-Bromophenylalanine?
The XLogP3-AA value of (R)-N-BOC-3-Bromophenylalanine is 3.2.
How many hydrogen bond donor counts does (R)-N-BOC-3-Bromophenylalanine have?
(R)-N-BOC-3-Bromophenylalanine has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does (R)-N-BOC-3-Bromophenylalanine have?
(R)-N-BOC-3-Bromophenylalanine has 4 hydrogen bond acceptor counts.
※ Please kindly note that our products are for research use only.