What is the molecular formula of 2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine nickel(II)?
The molecular formula is C36H44N4Ni.
When was 2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine nickel(II) created and modified?
It was created on 2005-03-27 and last modified on 2023-12-02.
What is the molecular weight of 2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine nickel(II)?
The molecular weight is 591.5 g/mol.
What is the IUPAC Name of 2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine nickel(II)?
The IUPAC Name is nickel(2+);2,3,7,8,12,13,17,18-octaethylporphyrin-22,24-diide.
What is the InChI of 2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine nickel(II)?
The InChI is InChI=1S/C36H44N4.Ni/c1-9-21-22(10-2)30-18-32-25(13-5)26(14-6)34(39-32)20-36-28(16-8)27(15-7)35(40-36)19-33-24(12-4)23(11-3)31(38-33)17-29(21)37-30;/h17-20H,9-16H2,1-8H3;/q-2;+2.
What is the InChIKey of 2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine nickel(II)?
The InChIKey is DIGQQRGHPATISA-UHFFFAOYSA-N.
What is the Canonical SMILES of 2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine nickel(II)?
The Canonical SMILES is CCC1=C(C2=CC3=NC(=CC4=C(C(=C([N-]4)C=C5C(=C(C(=N5)C=C1[N-]2)CC)CC)CC)C(=C3CC)CC)CC).[Ni+2].
What is the CAS number of 2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine nickel(II)?
The CAS number is 24803-99-4.
What is the hydrogen bond donor count of 2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine nickel(II)?
The hydrogen bond donor count is 0.
What is the covalently-bonded unit count of 2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine nickel(II)?
The covalently-bonded unit count is 2.
※ Please kindly note that our products are for research use only.