What is the molecular formula of 9,9-Dihexylfluorene-2,7-bis(trimethyleneborate)?
The molecular formula is C31H44B2O4.
What is the molecular weight of 9,9-Dihexylfluorene-2,7-bis(trimethyleneborate)?
The molecular weight is 502.3 g/mol.
What is the IUPAC name of 9,9-Dihexylfluorene-2,7-bis(trimethyleneborate)?
The IUPAC name is 2-[7-(1,3,2-dioxaborinan-2-yl)-9,9-dihexylfluoren-2-yl]-1,3,2-dioxaborinane.
What is the InChI of 9,9-Dihexylfluorene-2,7-bis(trimethyleneborate)?
The InChI is InChI=1S/C31H44B2O4/c1-3-5-7-9-17-31(18-10-8-6-4-2)29-23-25(32-34-19-11-20-35-32)13-15-27(29)28-16-14-26(24-30(28)31)33-36-21-12-22-37-33/h13-16,23-24H,3-12,17-22H2,1-2H3.
What is the InChIKey of 9,9-Dihexylfluorene-2,7-bis(trimethyleneborate)?
The InChIKey is SHZXKQJLRLVYGP-UHFFFAOYSA-N.
What is the canonical SMILES of 9,9-Dihexylfluorene-2,7-bis(trimethyleneborate)?
The canonical SMILES is B1(OCCCO1)C2=CC3=C(C=C2)C4=C(C3(CCCCCC)CCCCCC)C=C(C=C4)B5OCCCO5.
What is the CAS number of 9,9-Dihexylfluorene-2,7-bis(trimethyleneborate)?
The CAS number is 250597-29-6.
What is the hydrogen bond donor count of 9,9-Dihexylfluorene-2,7-bis(trimethyleneborate)?
The hydrogen bond donor count is 0.
What is the hydrogen bond acceptor count of 9,9-Dihexylfluorene-2,7-bis(trimethyleneborate)?
The hydrogen bond acceptor count is 4.
What is the rotatable bond count of 9,9-Dihexylfluorene-2,7-bis(trimethyleneborate)?
The rotatable bond count is 12.
※ Please kindly note that our products are for research use only.