What is the molecular formula of 1,8-Octanedioic-d12 acid?
The molecular formula of 1,8-Octanedioic-d12 acid is C8H14O4.
What is the molecular weight of 1,8-Octanedioic-d12 acid?
The molecular weight of 1,8-Octanedioic-d12 acid is 186.27 g/mol.
What is the IUPAC name of 1,8-Octanedioic-d12 acid?
The IUPAC name of 1,8-Octanedioic-d12 acid is 2,2,3,3,4,4,5,5,6,6,7,7-dodecadeuteriooctanedioic acid.
What is the InChI of 1,8-Octanedioic-d12 acid?
The InChI of 1,8-Octanedioic-d12 acid is InChI=1S/C8H14O4/c9-7(10)5-3-1-2-4-6-8(11)12/h1-6H2,(H,9,10)(H,11,12)/i1D2,2D2,3D2,4D2,5D2,6D2.
What is the InChIKey of 1,8-Octanedioic-d12 acid?
The InChIKey of 1,8-Octanedioic-d12 acid is TYFQFVWCELRYAO-LBTWDOQPSA-N.
What is the canonical SMILES of 1,8-Octanedioic-d12 acid?
The canonical SMILES of 1,8-Octanedioic-d12 acid is C(CCCC(=O)O)CCC(=O)O.
What is the isomeric SMILES of 1,8-Octanedioic-d12 acid?
The isomeric SMILES of 1,8-Octanedioic-d12 acid is [2H]C([2H])(C(=O)O)C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O.
What is the XLogP3 value of 1,8-Octanedioic-d12 acid?
The XLogP3 value of 1,8-Octanedioic-d12 acid is 1.
How many hydrogen bond donor counts does 1,8-Octanedioic-d12 acid have?
1,8-Octanedioic-d12 acid has 2 hydrogen bond donor counts.
How many rotatable bond counts does 1,8-Octanedioic-d12 acid have?
1,8-Octanedioic-d12 acid has 7 rotatable bond counts.