What is the molecular formula of O-(2-Acetamido-2-Deoxy-d-glucopyranosyl)-L-serine?
The molecular formula is C11H20N2O8.
What is the molecular weight of O-(2-Acetamido-2-Deoxy-d-glucopyranosyl)-L-serine?
The molecular weight is 308.29 g/mol.
What is the InChI of O-(2-Acetamido-2-Deoxy-d-glucopyranosyl)-L-serine?
The InChI is InChI=1S/C11H20N2O8/c1-4(15)13-7-9(17)8(16)6(2-14)21-11(7)20-3-5(12)10(18)19/h5-9,11,14,16-17H,2-3,12H2,1H3,(H,13,15)(H,18,19)/t5-,6+,7+,8+,9+,11+/m0/s1
What is the Canonical SMILES of O-(2-Acetamido-2-Deoxy-d-glucopyranosyl)-L-serine?
The Canonical SMILES is CC(=O)NC1C(C(C(OC1OCC(C(=O)O)N)CO)O)O
How many Hydrogen Bond Donor Count does O-(2-Acetamido-2-Deoxy-d-glucopyranosyl)-L-serine have?
O-(2-Acetamido-2-Deoxy-d-glucopyranosyl)-L-serine has 6 hydrogen bond donor counts.
What is the Topological Polar Surface Area of O-(2-Acetamido-2-Deoxy-d-glucopyranosyl)-L-serine?
The Topological Polar Surface Area is 172 Ų.
How many Rotatable Bond Count does O-(2-Acetamido-2-Deoxy-d-glucopyranosyl)-L-serine have?
It has 6 rotatable bond counts.
What is the XLogP3-AA value of O-(2-Acetamido-2-Deoxy-d-glucopyranosyl)-L-serine?
The XLogP3-AA value is -5.6.
What is the Formal Charge of O-(2-Acetamido-2-Deoxy-d-glucopyranosyl)-L-serine?
The formal charge is 0.
How many Defined Atom Stereocenter Counts does O-(2-Acetamido-2-Deoxy-d-glucopyranosyl)-L-serine have?
It has 6 defined atom stereocenter counts.
※ Please kindly note that our products are for research use only.