What is the molecular formula of 1,6-Bis(cyano-guanidino)hexane?
The molecular formula is C10H18N8.
What are the synonyms of 1,6-Bis(cyano-guanidino)hexane?
The synonyms are 15894-70-9, N,N'''-1,6-Hexanediylbis(N'-cyanoguanidine), 1,6-di(cyanoguanidino)hexane, and Guanidine, N,N'''-1,6-hexanediylbis[N'-cyano-.
What is the molecular weight of 1,6-Bis(cyano-guanidino)hexane?
The molecular weight is 250.30 g/mol.
When was 1,6-Bis(cyano-guanidino)hexane created and modified?
It was created on 2005-08-08 and modified on 2023-10-21.
What is the IUPAC name of 1,6-Bis(cyano-guanidino)hexane?
The IUPAC name is 2-[6-[[amino-(cyanoamino)methylidene]amino]hexyl]-1-cyanoguanidine.
What is the InChI of 1,6-Bis(cyano-guanidino)hexane?
The InChI is InChI=1S/C10H18N8/c11-7-17-9(13)15-5-3-1-2-4-6-16-10(14)18-8-12/h1-6H2,(H3,13,15,17)(H3,14,16,18).
What is the InChIKey of 1,6-Bis(cyano-guanidino)hexane?
The InChIKey is YXZZOMVBHPCKMM-UHFFFAOYSA-N.
What is the Canonical SMILES of 1,6-Bis(cyano-guanidino)hexane?
The Canonical SMILES is C(CCCN=C(N)NC#N)CCN=C(N)NC#N.
What is the CAS number of 1,6-Bis(cyano-guanidino)hexane?
The CAS number is 15894-70-9.
What are the computed properties of 1,6-Bis(cyano-guanidino)hexane?
The computed properties include: XLogP3-AA: -0.5 Hydrogen Bond Donor Count: 4 Hydrogen Bond Acceptor Count: Rotatable Bond Count: 9 Exact Mass: 250.16544261 g/mol Topological Polar Surface Area: 148Ų Heavy Atom Count: 18 Formal Charge: 0 Complexity: 341 Isotope Atom Count: Defined Atom Stereocenter Count: Undefined Atom Stereocenter Count: Defined Bond Stereocenter Count: Undefined Bond Stereocenter Count: Covalently-Bonded Unit Count: 1 Compound Is Canonicalized: Yes.
※ Please kindly note that our products are for research use only.