What is the PubChem CID of SiC Nanowires?
The PubChem CID of SiC Nanowires is 74071.
What is the molecular formula of SiC Nanowires?
The molecular formula of SiC Nanowires is C21H24O2.
What are some synonyms of SiC Nanowires?
Some synonyms of SiC Nanowires include 1568-80-5, 3,3,3',3'-tetramethyl-2,2',3,3'-tetrahydro-1,1'-spirobi[indene]-6,6'-diol, SPIROBIINDANE, HIV-1 integrase inhibitor 8, and more.
What is the molecular weight of SiC Nanowires?
The molecular weight of SiC Nanowires is 308.4 g/mol.
What is the IUPAC name of SiC Nanowires?
The IUPAC name of SiC Nanowires is 1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-5,5'-diol.
What is the InChI of SiC Nanowires?
The InChI of SiC Nanowires is InChI=1S/C21H24O2/c1-19(2)11-21(17-9-13(22)5-7-15(17)19)12-20(3,4)16-8-6-14(23)10-18(16)21/h5-10,22-23H,11-12H2,1-4H3.
What is the InChIKey of SiC Nanowires?
The InChIKey of SiC Nanowires is SICLLPHPVFCNTJ-UHFFFAOYSA-N.
What is the canonical SMILES of SiC Nanowires?
The canonical SMILES of SiC Nanowires is CC1(CC2(CC(C3=C2C=C(C=C3)O)(C)C)C4=C1C=CC(=C4)O)C.
What is the CAS number of SiC Nanowires?
The CAS number of SiC Nanowires is 1568-80-5.
Is SiC Nanowires a canonicalized compound?
Yes, SiC Nanowires is a canonicalized compound according to PubChem.