What is the molecular formula of 1,4-Dioxane-2,3-diol?
The molecular formula of 1,4-Dioxane-2,3-diol is C4H8O4.
What is the molecular weight of 1,4-Dioxane-2,3-diol?
The molecular weight of 1,4-Dioxane-2,3-diol is 120.10 g/mol.
What is the IUPAC name of 1,4-Dioxane-2,3-diol?
The IUPAC name of 1,4-Dioxane-2,3-diol is 1,4-dioxane-2,3-diol.
What is the InChI of 1,4-Dioxane-2,3-diol?
The InChI of 1,4-Dioxane-2,3-diol is InChI=1S/C4H8O4/c5-3-4(6)8-2-1-7-3/h3-6H,1-2H2.
What is the InChIKey of 1,4-Dioxane-2,3-diol?
The InChIKey of 1,4-Dioxane-2,3-diol is YLVACWCCJCZITJ-UHFFFAOYSA-N.
What is the canonical SMILES of 1,4-Dioxane-2,3-diol?
The canonical SMILES of 1,4-Dioxane-2,3-diol is C1COC(C(O1)O)O.
What is the CAS number of 1,4-Dioxane-2,3-diol?
The CAS number of 1,4-Dioxane-2,3-diol is 4845-50-5.
What is the EC number of 1,4-Dioxane-2,3-diol?
The EC number of 1,4-Dioxane-2,3-diol is 225-431-3.
What is the XLogP3-AA value of 1,4-Dioxane-2,3-diol?
The XLogP3-AA value of 1,4-Dioxane-2,3-diol is -1.3.
Is 1,4-Dioxane-2,3-diol a canonicalized compound?
Yes, 1,4-Dioxane-2,3-diol is a canonicalized compound.