What is the molecular formula of 1,2-Dichlorobutane?
The molecular formula of 1,2-Dichlorobutane is C4H8Cl2.
What is the molecular weight of 1,2-Dichlorobutane?
The molecular weight of 1,2-Dichlorobutane is 127.01 g/mol.
What is the IUPAC name of 1,2-Dichlorobutane?
The IUPAC name of 1,2-Dichlorobutane is 1,2-dichlorobutane.
What is the InChI of 1,2-Dichlorobutane?
The InChI of 1,2-Dichlorobutane is InChI=1S/C4H8Cl2/c1-2-4(6)3-5/h4H,2-3H2,1H3.
What is the InChIKey of 1,2-Dichlorobutane?
The InChIKey of 1,2-Dichlorobutane is PQBOTZNYFQWRHU-UHFFFAOYSA-N.
What is the canonical SMILES of 1,2-Dichlorobutane?
The canonical SMILES of 1,2-Dichlorobutane is CCC(CCl)Cl.
What is the CAS number of 1,2-Dichlorobutane?
The CAS number of 1,2-Dichlorobutane is 616-21-7.
What is the DSSTox Substance ID of 1,2-Dichlorobutane?
The DSSTox Substance ID of 1,2-Dichlorobutane is DTXSID8027244.
What is the XLogP3-AA value of 1,2-Dichlorobutane?
The XLogP3-AA value of 1,2-Dichlorobutane is 2.4.
What is the topological polar surface area of 1,2-Dichlorobutane?
The topological polar surface area of 1,2-Dichlorobutane is 0Ų.