What is the molecular formula of 1-Chloro-2-methylbutane?
The molecular formula is C5H11Cl.
What is the molecular weight of 1-Chloro-2-methylbutane?
The molecular weight is 106.59 g/mol.
What is the IUPAC name of 1-Chloro-2-methylbutane?
The IUPAC name is 1-chloro-2-methylbutane.
What is the InChI of 1-Chloro-2-methylbutane?
The InChI is InChI=1S/C5H11Cl/c1-3-5(2)4-6/h5H,3-4H2,1-2H3.
What is the InChIKey of 1-Chloro-2-methylbutane?
The InChIKey is IWAKWOFEHSYKSI-UHFFFAOYSA-N.
How many hydrogen bond donor counts does 1-Chloro-2-methylbutane have?
1-Chloro-2-methylbutane has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 1-Chloro-2-methylbutane have?
1-Chloro-2-methylbutane has 0 hydrogen bond acceptor counts.
How many rotatable bond counts does 1-Chloro-2-methylbutane have?
1-Chloro-2-methylbutane has 2 rotatable bond counts.
What is the topological polar surface area of 1-Chloro-2-methylbutane?
The topological polar surface area is 0Ų.
Is 1-Chloro-2-methylbutane a canonicalized compound?
Yes, 1-Chloro-2-methylbutane is a canonicalized compound.