What is the PubChem CID number of zeinoxanthin?
PubChem CID number of zeinoxanthin is 5281234.
What is the molecular formula of zeinoxanthin?
The molecular formula of zeinoxanthin is C40H56O.
When was zeinoxanthin created and modified?
Zeinoxanthin was created on June 24, 2005, and last modified on December 30, 2023.
Where is zeinoxanthin found in nature?
Zeinoxanthin is found in organisms such as Cladonia gracilis, Cladonia rangiferina, and others.
What is the IUPAC name of zeinoxanthin?
The IUPAC name of zeinoxanthin is (1R)-3,5,5-trimethyl-4-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-18-[(1R)-2,6,6-trimethylcyclohex-2-en-1-yl]octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohex-3-en-1-ol.
What is the InChI of zeinoxanthin?
The InChI of zeinoxanthin is InChI=1S/C40H56O/c1-30(18-13-20-32(3)23-25-37-34(5)22-15-27-39(37,7)8)16-11-12-17-31(2)19-14-21-33(4)24-26-38-35(6)28-36(41)29-40(38,9)10/h11-14,16-26,36-37,41H,15,27-29H2,1-10H3/b12-11+,18-13+,19-14+,25-23+,26-24+,30-16+,31-17+,32-20+,33-21+/t36-,37+/m1/s1.
What is the molecular weight of zeinoxanthin?
The molecular weight of zeinoxanthin is 552.9 g/mol.
What is the Canonical SMILES of zeinoxanthin?
The Canonical SMILES of zeinoxanthin is CC1=C(C(CC(C1)O)(C)C)C=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC2C(=CCCC2(C)C)C)C)C.
What is the UNII of zeinoxanthin?
The UNII of zeinoxanthin is J02CU7E14H.
What is the CAS number of zeinoxanthin?
The CAS number of zeinoxanthin is 24480-38-4.