What is the molecular formula of z-Sar-OH?
The molecular formula of z-Sar-OH is C11H13NO4.
What is the molecular weight of z-Sar-OH?
The molecular weight of z-Sar-OH is 223.22 g/mol.
When was z-Sar-OH created and modified?
z-Sar-OH was created on March 26, 2005, and last modified on November 25, 2023.
What is the IUPAC name of z-Sar-OH?
The IUPAC name of z-Sar-OH is 2-[methyl(phenylmethoxycarbonyl)amino]acetic acid.
What is the InChI of z-Sar-OH?
The InChI of z-Sar-OH is InChI=1S/C11H13NO4/c1-12(7-10(13)14)11(15)16-8-9-5-3-2-4-6-9/h2-6H,7-8H2,1H3,(H,13,14).
What is the InChIKey of z-Sar-OH?
The InChIKey of z-Sar-OH is CBWFTZNMONHKNZ-UHFFFAOYSA-N.
What is the Canonical SMILES of z-Sar-OH?
The Canonical SMILES of z-Sar-OH is CN(CC(=O)O)C(=O)OCC1=CC=CC=C1.
What is the CAS number of z-Sar-OH?
The CAS number of z-Sar-OH is 39608-31-6.
What is the XLogP3 value of z-Sar-OH?
The XLogP3 value of z-Sar-OH is 1.8.
Is z-Sar-OH a canonicalized compound?
Yes, z-Sar-OH is a canonicalized compound.