What is the molecular formula of z-Lys(boc)-oh?
The molecular formula of z-Lys(boc)-oh is C19H28N2O6.
What is the molecular weight of z-Lys(boc)-oh?
The molecular weight of z-Lys(boc)-oh is 380.4 g/mol.
What is the IUPAC name of z-Lys(boc)-oh?
The IUPAC name of z-Lys(boc)-oh is (2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoic acid.
What is the InChI of z-Lys(boc)-oh?
The InChI of z-Lys(boc)-oh is InChI=1S/C19H28N2O6/c1-19(2,3)27-17(24)20-12-8-7-11-15(16(22)23)21-18(25)26-13-14-9-5-4-6-10-14/h4-6,9-10,15H,7-8,11-13H2,1-3H3,(H,20,24)(H,21,25)(H,22,23)/t15-/m0/s1.
What is the InChIKey of z-Lys(boc)-oh?
The InChIKey of z-Lys(boc)-oh is DYSBKEOCHROEGX-HNNXBMFYSA-N.
What is the Canonical SMILES of z-Lys(boc)-oh?
The Canonical SMILES of z-Lys(boc)-oh is CC(C)(C)OC(=O)NCCCCC(C(=O)O)NC(=O)OCC1=CC=CC=C1.
How many hydrogen bond donor atoms are present in z-Lys(boc)-oh?
There are 3 hydrogen bond donor atoms in z-Lys(boc)-oh.
How many hydrogen bond acceptor atoms are present in z-Lys(boc)-oh?
There are 6 hydrogen bond acceptor atoms in z-Lys(boc)-oh.
How many rotatable bonds are present in z-Lys(boc)-oh?
There are 12 rotatable bonds present in z-Lys(boc)-oh.