What is the molecular formula of z-Gly-sar-oh?
The molecular formula of z-Gly-sar-oh is C13H16N2O5.
What is the molecular weight of z-Gly-sar-oh?
The molecular weight of z-Gly-sar-oh is 280.28 g/mol.
What is the IUPAC name of z-Gly-sar-oh?
The IUPAC name of z-Gly-sar-oh is 2-[methyl-[2-(phenylmethoxycarbonylamino)acetyl]amino]acetic acid.
What is the InChI code of z-Gly-sar-oh?
The InChI code of z-Gly-sar-oh is InChI=1S/C13H16N2O5/c1-15(8-12(17)18)11(16)7-14-13(19)20-9-10-5-3-2-4-6-10/h2-6H,7-9H2,1H3,(H,14,19)(H,17,18).
What is the InChIKey of z-Gly-sar-oh?
The InChIKey of z-Gly-sar-oh is DNSQLCGFBZSRPW-UHFFFAOYSA-N.
What is the Canonical SMILES of z-Gly-sar-oh?
The Canonical SMILES of z-Gly-sar-oh is CN(CC(=O)O)C(=O)CNC(=O)OCC1=CC=CC=C1.
What is the CAS number of z-Gly-sar-oh?
The CAS number of z-Gly-sar-oh is 7801-91-4.
What is the XLogP3-AA value of z-Gly-sar-oh?
The XLogP3-AA value of z-Gly-sar-oh is 0.6.
How many hydrogen bond donor counts does z-Gly-sar-oh have?
z-Gly-sar-oh has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does z-Gly-sar-oh have?
z-Gly-sar-oh has 5 hydrogen bond acceptor counts.