What is the molecular formula of Z-5-Dodecenyl acetate?
The molecular formula of Z-5-Dodecenyl acetate is C14H26O2.
What is the molecular weight of Z-5-Dodecenyl acetate?
The molecular weight of Z-5-Dodecenyl acetate is 226.35 g/mol.
What is the IUPAC name of Z-5-Dodecenyl acetate?
The IUPAC name of Z-5-Dodecenyl acetate is [(Z)-dodec-5-enyl] acetate.
What is the InChI of Z-5-Dodecenyl acetate?
The InChI of Z-5-Dodecenyl acetate is InChI=1S/C14H26O2/c1-3-4-5-6-7-8-9-10-11-12-13-16-14(2)15/h8-9H,3-7,10-13H2,1-2H3/b9-8-.
What is the InChIKey of Z-5-Dodecenyl acetate?
The InChIKey of Z-5-Dodecenyl acetate is FOEWNRTZASNZJY-HJWRWDBZSA-N.
What is the canonical SMILES of Z-5-Dodecenyl acetate?
The canonical SMILES of Z-5-Dodecenyl acetate is CCCCCCC=CCCCCOC(=O)C.
What is the CAS number of Z-5-Dodecenyl acetate?
The CAS number of Z-5-Dodecenyl acetate is 16676-96-3.
What is the XLogP3-AA value of Z-5-Dodecenyl acetate?
The XLogP3-AA value of Z-5-Dodecenyl acetate is 4.8.
How many rotatable bonds are there in Z-5-Dodecenyl acetate?
There are 11 rotatable bonds in Z-5-Dodecenyl acetate.
What is the topological polar surface area of Z-5-Dodecenyl acetate?
The topological polar surface area of Z-5-Dodecenyl acetate is 26.3 ?2.