What is the molecular formula of Z-11-Hexadecenyl acetate?
The molecular formula is C18H34O2.
What is the molecular weight of Z-11-Hexadecenyl acetate?
The molecular weight is 282.5 g/mol.
What is the IUPAC name of Z-11-Hexadecenyl acetate?
The IUPAC name is [(Z)-hexadec-11-enyl] acetate.
What is the InChI of Z-11-Hexadecenyl acetate?
The InChI is InChI=1S/C18H34O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-18(2)19/h6-7H,3-5,8-17H2,1-2H3/b7-6-.
What is the InChIKey of Z-11-Hexadecenyl acetate?
The InChIKey is BTKXLQSCEOHKTF-SREVYHEPSA-N.
What is the CAS number of Z-11-Hexadecenyl acetate?
The CAS number is 34010-21-4.
What is the European Community (EC) Number of Z-11-Hexadecenyl acetate?
The European Community (EC) Number is 251-791-6.
What is the UNII of Z-11-Hexadecenyl acetate?
The UNII is 2TVB86A4XQ.
What is the Lipid Maps ID (LM_ID) of Z-11-Hexadecenyl acetate?
The Lipid Maps ID is LMFA07010362.
What is the XLogP3-AA of Z-11-Hexadecenyl acetate?
The XLogP3-AA is 6.9.