Xylulose-5-phosphate

• CAS: 60802-29-1
• Catalog Number: ACM60802291
• Category: Other Products
• Molecular Weight: 0
• Molecular Formula: C₅H₁₁O₈P
• Synonyms: (2,3,5-trihydroxy-4-oxopentyl) dihydrogen phosphate;2-Pentulose 5-(dihydrogen phosphate)

Custom Q&A

What is the molecular formula of xylulose-5-phosphate?

The molecular formula of xylulose-5-phosphate is C5H11O8P.

What is the molecular weight of xylulose-5-phosphate?

The molecular weight of xylulose-5-phosphate is 230.11 g/mol.

What is the IUPAC name of xylulose-5-phosphate?

The IUPAC name of xylulose-5-phosphate is [(2R,3S)-2,3,5-trihydroxy-4-oxopentyl] dihydrogen phosphate.

What is the canonical SMILES notation for xylulose-5-phosphate?

The canonical SMILES notation for xylulose-5-phosphate is C(C(C(C(=O)CO)O)O)OP(=O)(O)O.

What is the CAS number for xylulose-5-phosphate?

The CAS number for xylulose-5-phosphate is 4212-65-1.

What is the XLogP3-AA value for xylulose-5-phosphate?

The XLogP3-AA value for xylulose-5-phosphate is -3.7.

How many hydrogen bond donor counts does xylulose-5-phosphate have?

Xylulose-5-phosphate has 5 hydrogen bond donor counts.

What is the exact mass of xylulose-5-phosphate?

The exact mass of xylulose-5-phosphate is 230.01915430 g/mol.

What is the topological polar surface area of xylulose-5-phosphate?

The topological polar surface area of xylulose-5-phosphate is 145?2.

What is the heavy atom count of xylulose-5-phosphate?

The heavy atom count of xylulose-5-phosphate is 14.