What is the molecular formula of UV-320?
The molecular formula of UV-320 is C20H25N3O.
What is the molecular weight of UV-320?
The molecular weight of UV-320 is 323.4 g/mol.
When was UV-320 created?
UV-320 was created on August 8, 2005.
When was UV-320 last modified?
UV-320 was last modified on December 30, 2023.
What is the IUPAC name of UV-320?
The IUPAC name of UV-320 is 2-(benzotriazol-2-yl)-4,6-ditert-butylphenol.
What is the InChI of UV-320?
The InChI of UV-320 is InChI=1S/C20H25N3O/c1-19(2,3)13-11-14(20(4,5)6)18(24)17(12-13)23-21-15-9-7-8-10-16(15)22-23/h7-12,24H,1-6H3.
What is the InChIKey of UV-320?
The InChIKey of UV-320 is LHPPDQUVECZQSW-UHFFFAOYSA-N.
What is the canonical SMILES of UV-320?
The canonical SMILES of UV-320 is CC(C)(C)C1=CC(=C(C(=C1)N2N=C3C=CC=CC3=N2)O)C(C)(C)C.
What is the CAS number of UV-320?
The CAS number of UV-320 is 3846-71-7.
What is the UNII of UV-320?
The UNII of UV-320 is US7KL87A2P.