What is the molecular formula of Uniconazole?
The molecular formula of Uniconazole is C15H18ClN3O.
What is the molecular weight of Uniconazole?
The molecular weight of Uniconazole is 291.77 g/mol.
What is the IUPAC name of Uniconazole?
The IUPAC name of Uniconazole is (E)-1-(4-chlorophenyl)-4,4-dimethyl-2-(1,2,4-triazol-1-yl)pent-1-en-3-ol.
What is the InChl key of Uniconazole?
The InChl key of Uniconazole is YNWVFADWVLCOPU-MDWZMJQESA-N.
What are the synonyms of Uniconazole?
The synonyms of Uniconazole are Uniconazole, Uniconazole [ISO], (E)-1-(4-Chlorophenyl)-4,4-dimethyl-2-(1H-1,2,4-triazol-1-yl)pent-1-en-3-ol, XE 1019D, and more.
What is the CAS number of Uniconazole?
The CAS number of Uniconazole is 83657-22-1.
How many hydrogen bond donor counts does Uniconazole have?
Uniconazole has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does Uniconazole have?
Uniconazole has 3 hydrogen bond acceptor counts.
What is the topological polar surface area of Uniconazole?
The topological polar surface area of Uniconazole is 50.9?2.
What is the formal charge of Uniconazole?
The formal charge of Uniconazole is 0.
What is the InChI of uniconazole?
The InChI of uniconazole is InChI=1S/C15H18ClN3O/c1-15(2,3)14(20)13(19-10-17-9-18-19)8-11-4-6-12(16)7-5-11/h4-10,14,20H,1-3H3/b13-8+.
What is the InChIKey of uniconazole?
The InChIKey of uniconazole is YNWVFADWVLCOPU-MDWZMJQESA-N.
What is the canonical SMILES of uniconazole?
The canonical SMILES of uniconazole is CC(C)(C)C(C(=CC1=CC=C(C=C1)Cl)N2C=NC=N2)O.
What is the UNII of uniconazole?
The UNII of uniconazole is R4ATA06H50.
What is the ChEMBL ID of uniconazole?
The ChEMBL ID of uniconazole is CHEMBL138177.
What is the Wikipedia page for uniconazole?
The Wikipedia page for uniconazole is titled "Uniconazole".