What is the molecular formula of Tutin?
The molecular formula of Tutin is C15H18O6.
What are the synonyms of Tutin?
The synonyms of Tutin include Tutine, Tutu, Toot poison, (+)-Tutin, and more.
What is the IUPAC name of Tutin?
The IUPAC name of Tutin is (1S,2R,3S,5R,6R,7R,8S,9R,12R)-2,8-dihydroxy-7-methyl-12-prop-1-en-2-ylspiro[4,10-dioxatetracyclo[7.2.1.02,7.03,5]dodecane-6,2'-oxirane]-11-one.
What is the InChI of Tutin?
The InChI of Tutin is InChI=1S/C15H18O6/c1-5(2)6-7-12(17)20-8(6)9(16)13(3)14(4-19-14)10-11(21-10)15(7,13)18/h6-11,16,18H,1,4H2,2-3H3/t6-,7+,8+,9+,10+,11-,13-,14+,15-/m0/s1.
What is the InChIKey of Tutin?
The InChIKey of Tutin is CCAZWUJBLXKBAY-ULZPOIKGSA-N.
What is the canonical SMILES of Tutin?
The canonical SMILES of Tutin is CC(=C)C1C2C(C3(C4(CO4)C5C(C3(C1C(=O)O2)O)O5)C)O.
What is the CAS number of Tutin?
The CAS number of Tutin is 2571-22-4.
What is the molecular weight of Tutin?
The molecular weight of Tutin is 294.30g/mol.
How many hydrogen bond donor counts does Tutin have?
Tutin has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Tutin have?
Tutin has 6 hydrogen bond acceptor counts.