What is the Chemical Safety Summary for Tripropargylamine?
The Chemical Safety Summary provides information on the safe handling and storage of Tripropargylamine in the laboratory.
What is the molecular formula of Tripropargylamine?
The molecular formula of Tripropargylamine is C9H9N.
What are the synonyms for Tripropargylamine?
The synonyms for Tripropargylamine include 6921-29-5, TRI-2-PROPYNYLAMINE, and TRIPROP-2-YNYLAMINE.
What is the molecular weight of Tripropargylamine?
The molecular weight of Tripropargylamine is 131.17 g/mol.
What is the IUPAC name of Tripropargylamine?
The IUPAC name of Tripropargylamine is N,N-bis(prop-2-ynyl)prop-2-yn-1-amine.
What is the InChI of Tripropargylamine?
The InChI of Tripropargylamine is InChI=1S/C9H9N/c1-4-7-10(8-5-2)9-6-3/h1-3H,7-9H2.
What is the InChIKey of Tripropargylamine?
The InChIKey of Tripropargylamine is ZHOBJWVNWMQMLF-UHFFFAOYSA-N.
What is the Canonical SMILES of Tripropargylamine?
The Canonical SMILES of Tripropargylamine is C#CCN(CC#C)CC#C.
What is the CAS number of Tripropargylamine?
The CAS number of Tripropargylamine is 6921-29-5.
Is Tripropargylamine a covalently-bonded unit?
Yes, Tripropargylamine is a covalently-bonded unit.