What is the molecular formula of Trimethylolpropane ethoxylate(1eo/oh)?
The molecular formula of Trimethylolpropane ethoxylate(1eo/oh) is C19H32O8.
What is the molecular weight of Trimethylolpropane ethoxylate(1eo/oh)?
The molecular weight of Trimethylolpropane ethoxylate(1eo/oh) is 388.5 g/mol.
When was Trimethylolpropane ethoxylate(1eo/oh) created?
Trimethylolpropane ethoxylate(1eo/oh) was created on September 15, 2005.
What is the IUPAC name of Trimethylolpropane ethoxylate(1eo/oh)?
The IUPAC name of Trimethylolpropane ethoxylate(1eo/oh) is 2-[2-(2-methoxyethoxymethyl)-2-(2-prop-2-enoyloxyethoxymethyl)butoxy]ethyl prop-2-enoate.
What is the InChI of Trimethylolpropane ethoxylate(1eo/oh)?
The InChI of Trimethylolpropane ethoxylate(1eo/oh) is InChI=1S/C19H32O8/c1-5-17(20)26-12-10-24-15-19(7-3,14-23-9-8-22-4)16-25-11-13-27-18(21)6-2/h5-6H,1-2,7-16H2,3-4H3.
What is the InChIKey of Trimethylolpropane ethoxylate(1eo/oh)?
The InChIKey of Trimethylolpropane ethoxylate(1eo/oh) is SBOXDRICSJHEBA-UHFFFAOYSA-N.
What is the Canonical SMILES of Trimethylolpropane ethoxylate(1eo/oh)?
The Canonical SMILES of Trimethylolpropane ethoxylate(1eo/oh) is CCC(COCCOC)(COCCOC(=O)C=C)COCCOC(=O)C=C.
What is the CAS number of Trimethylolpropane ethoxylate(1eo/oh)?
The CAS number of Trimethylolpropane ethoxylate(1eo/oh) is 302911-84-8.
What is the XLogP3-AA value of Trimethylolpropane ethoxylate(1eo/oh)?
The XLogP3-AA value of Trimethylolpropane ethoxylate(1eo/oh) is 1.6.
Is Trimethylolpropane ethoxylate(1eo/oh) a canonicalized compound?
Yes, Trimethylolpropane ethoxylate(1eo/oh) is a canonicalized compound.
※ Please kindly note that our products are for research use only.